Products 1020764-38-8
CAS 1020764-38-8 appears in our catalog under these names: Sumatriptan-d6, >95% (HPLC), Sumatriptan-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1-[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide (CAS 1020764-38-8) is a chemical compound with the molecular formula C14H21N3O2S and a molecular weight of 301.44 g/mol. IUPAC name: 1-[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide. InChIKey: KQKPFRSPSRPDEB-XERRXZQWSA-N.
| Molecular formula | C14H21N3O2S |
|---|---|
| Molecular weight | 301.44 g/mol |
| IUPAC name | 1-[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]-N-methylmethanesulfonamide |
| InChIKey | KQKPFRSPSRPDEB-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)NC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Sumatriptan-d6, Sumatriptan Base