CAS 102096-80-0 appears in our catalog under these names: Hydrazine Hydrate-d6, Hydrazine Hydrate-d6, 98 atom % D, min 98% Chemical Purity, HYDRAZINE-D4 MONODEUTERATE, 98 ATOM % D. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 500mg, 5g, 20G.
Deuterated water;1,1,2,2-tetradeuteriohydrazine (CAS 102096-80-0) is a chemical compound with the molecular formula H6N2O and a molecular weight of 56.098 g/mol. IUPAC name: deuterated water;1,1,2,2-tetradeuteriohydrazine. InChIKey: IKDUDTNKRLTJSI-YIKVAAQNSA-N.
| Molecular formula | H6N2O |
|---|---|
| Molecular weight | 56.098 g/mol |
| IUPAC name | deuterated water;1,1,2,2-tetradeuteriohydrazine |
| InChIKey | IKDUDTNKRLTJSI-YIKVAAQNSA-N |
| SMILES | [2H]N([2H])N([2H])[2H].[2H]O[2H] |
Computed by PubChem (NCBI)