Products 1020963-71-6
CAS 1020963-71-6 is the registry number for 1-Cyclopentanecarbonyl-2,3-dihydro-1h-indol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-amino-2,3-dihydroindol-1-yl)-cyclopentylmethanone (CAS 1020963-71-6) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: (5-amino-2,3-dihydroindol-1-yl)-cyclopentylmethanone. InChIKey: SSFDYSPJLXVWFN-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | (5-amino-2,3-dihydroindol-1-yl)-cyclopentylmethanone |
| InChIKey | SSFDYSPJLXVWFN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(=O)N2CCC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)