Products 1020972-76-2
CAS 1020972-76-2 appears in our catalog under these names: 3-Methyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine, 95%, 3-Methyl-1-(3-(trifluoromethyl)phenyl)butan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-methyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine (CAS 1020972-76-2) is a chemical compound with the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. IUPAC name: 3-methyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine. InChIKey: RCXBZUFVURRCHY-UHFFFAOYSA-N.
| Molecular formula | C12H16F3N |
|---|---|
| Molecular weight | 231.26 g/mol |
| IUPAC name | 3-methyl-1-[3-(trifluoromethyl)phenyl]butan-1-amine |
| InChIKey | RCXBZUFVURRCHY-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=CC(=CC=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)