CAS 10210-64-7 is the registry number for Bis(2,4–pentanedionato)beryllium. Offered by: GLPBio. Available pack sizes: 10g, 2g.
Beryllium bis((Z)-4-oxopent-2-en-2-olate) (CAS 10210-64-7) is a chemical compound with the molecular formula C10H14BeO4 and a molecular weight of 207.23 g/mol. IUPAC name: beryllium bis((Z)-4-oxopent-2-en-2-olate). InChIKey: BBKXDHBLPBKCFR-FDGPNNRMSA-L.
| Molecular formula | C10H14BeO4 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | beryllium bis((Z)-4-oxopent-2-en-2-olate) |
| InChIKey | BBKXDHBLPBKCFR-FDGPNNRMSA-L |
| SMILES | [Be+2].C/C(=C/C(=O)C)/[O-].C/C(=C/C(=O)C)/[O-] |
Computed by PubChem (NCBI)