CAS 1021038-07-2 is the registry number for 2-Chloro-n-cyclopentyl-4-fluoro-benzenemethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(2-chloro-4-fluorophenyl)methyl]cyclopentanamine (CAS 1021038-07-2) is a chemical compound with the molecular formula C12H15ClFN and a molecular weight of 227.70 g/mol. IUPAC name: N-[(2-chloro-4-fluorophenyl)methyl]cyclopentanamine. InChIKey: DKKRHOIERQZPEI-UHFFFAOYSA-N.
| Molecular formula | C12H15ClFN |
|---|---|
| Molecular weight | 227.70 g/mol |
| IUPAC name | N-[(2-chloro-4-fluorophenyl)methyl]cyclopentanamine |
| InChIKey | DKKRHOIERQZPEI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NCC2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)