CAS 1021186-08-2 is the registry number for 3-(Piperidin-1-ylmethyl)phenylboronic acid, pinacol ester hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine;hydrochloride (CAS 1021186-08-2) is a chemical compound with the molecular formula C18H29BClNO2 and a molecular weight of 337.7 g/mol. IUPAC name: 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine;hydrochloride. InChIKey: DCRYLAICZGZFJF-UHFFFAOYSA-N.
| Molecular formula | C18H29BClNO2 |
|---|---|
| Molecular weight | 337.7 g/mol |
| IUPAC name | 1-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperidine;hydrochloride |
| InChIKey | DCRYLAICZGZFJF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CN3CCCCC3.Cl |
Computed by PubChem (NCBI)