CAS 10212-13-2 appears in our catalog under these names: 3',5'-Di-O-acetyl-2'-deoxy-2'-fluorouridine, 3′,5′-Di-O-acetyl-2′-deoxy-2′-fluorouridine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 500mg, 50mg, 1000mg, 2000mg, 5000mg, 10000mg, 50 mg.
[(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl acetate (CAS 10212-13-2) is a chemical compound with the molecular formula C13H15FN2O7 and a molecular weight of 330.27 g/mol. IUPAC name: [(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl acetate. InChIKey: SGWNQYIJJOVQCM-HJQYOEGKSA-N.
| Molecular formula | C13H15FN2O7 |
|---|---|
| Molecular weight | 330.27 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3-acetyloxy-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl acetate |
| InChIKey | SGWNQYIJJOVQCM-HJQYOEGKSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=O)NC2=O)F)OC(=O)C |
Computed by PubChem (NCBI)