CAS 1021236-09-8 appears in our catalog under these names: 4-(2-Bromo-4-methylphenoxy)-3-chloroaniline, 95%, 4-(2-Bromo-4-methylphenoxy)-3-chloroaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-(2-bromo-4-methylphenoxy)-3-chloroaniline (CAS 1021236-09-8) is a chemical compound with the molecular formula C13H11BrClNO and a molecular weight of 312.59 g/mol. IUPAC name: 4-(2-bromo-4-methylphenoxy)-3-chloroaniline. InChIKey: SZSONLWWCHIHJC-UHFFFAOYSA-N.
| Molecular formula | C13H11BrClNO |
|---|---|
| Molecular weight | 312.59 g/mol |
| IUPAC name | 4-(2-bromo-4-methylphenoxy)-3-chloroaniline |
| InChIKey | SZSONLWWCHIHJC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=C(C=C(C=C2)N)Cl)Br |
Computed by PubChem (NCBI)