CAS 1021240-67-4 is the registry number for 2-Chloro-6-(dimethylamino)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-6-(dimethylamino)benzaldehyde (CAS 1021240-67-4) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 2-chloro-6-(dimethylamino)benzaldehyde. InChIKey: HWZUGJLCRJPTPE-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 2-chloro-6-(dimethylamino)benzaldehyde |
| InChIKey | HWZUGJLCRJPTPE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=CC=C1)Cl)C=O |
Computed by PubChem (NCBI)