Products 1021245-11-3
CAS 1021245-11-3 appears in our catalog under these names: 2,5-Dimethyl-N-(2,2,2-trifluoroethyl)aniline, 95%, 95%, 2,5-Dimethyl-N-(2,2,2-trifluoroethyl)aniline, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 25g, 250mg, 10g, 50g.
2,5-dimethyl-N-(2,2,2-trifluoroethyl)aniline (CAS 1021245-11-3) is a chemical compound with the molecular formula C10H12F3N and a molecular weight of 203.20 g/mol. IUPAC name: 2,5-dimethyl-N-(2,2,2-trifluoroethyl)aniline. InChIKey: FWZLQBNJQNDAQM-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2,5-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | FWZLQBNJQNDAQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NCC(F)(F)F |
Computed by PubChem (NCBI)