CAS 102130-93-8 is the registry number for rel-(2S,3S)-2-Amino-4-fluoro-3-hydroxybutanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-L-threonine is a fluoroamino acid, a non-proteinogenic L-alpha-amino acid and a L-threonine derivative. It is a tautomer of a 4-fluoro-L-threonine zwitterion.
Source: ChEBI
| Molecular formula | C4H8FNO3 |
|---|---|
| Molecular weight | 137.11 g/mol |
| IUPAC name | (2S,3S)-2-amino-4-fluoro-3-hydroxybutanoic acid |
| InChIKey | GTFWIYJIEXNAOL-GBXIJSLDSA-N |
| SMILES | C([C@H]([C@@H](C(=O)O)N)O)F |
Computed by PubChem (NCBI)