Products 1021342-97-1
CAS 1021342-97-1 is the registry number for (1-(tert-Butoxycarbonyl)-5-(piperidine-1-carbonyl)-1H-indol-2-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(piperidine-1-carbonyl)indol-2-yl]boronic acid (CAS 1021342-97-1) is a chemical compound with the molecular formula C19H25BN2O5 and a molecular weight of 372.2 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(piperidine-1-carbonyl)indol-2-yl]boronic acid. InChIKey: SGVLBCSJEPDDRZ-UHFFFAOYSA-N.
| Molecular formula | C19H25BN2O5 |
|---|---|
| Molecular weight | 372.2 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(piperidine-1-carbonyl)indol-2-yl]boronic acid |
| InChIKey | SGVLBCSJEPDDRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)C(=O)N3CCCCC3)(O)O |
Computed by PubChem (NCBI)