CAS 1021389-31-0 appears in our catalog under these names: 2-(2-Fluoro-5-nitrophenyl)ethanol, 95%, 2–(2–Fluoro–5–Nitrophenyl)Ethanol, 2-(2-Fluoro-5-nitrophenyl)ethanol. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g.
2-(2-fluoro-5-nitrophenyl)ethanol (CAS 1021389-31-0) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)ethanol. InChIKey: MCHWKGNTOWXQDV-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)ethanol |
| InChIKey | MCHWKGNTOWXQDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CCO)F |
Computed by PubChem (NCBI)