CAS 1021432-55-2 is the registry number for 5-Cyclopropyl-2,3-dihydro-1H-inden-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-cyclopropyl-2,3-dihydroinden-1-one (CAS 1021432-55-2) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: 5-cyclopropyl-2,3-dihydroinden-1-one. InChIKey: QVJJDNPUHLZWNV-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 5-cyclopropyl-2,3-dihydroinden-1-one |
| InChIKey | QVJJDNPUHLZWNV-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(C=C2)C(=O)CC3 |
Computed by PubChem (NCBI)