CAS 1021441-40-6 is the registry number for L-Selenocystine Dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg.
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid;dihydrochloride (CAS 1021441-40-6) is a chemical compound with the molecular formula C6H14Cl2N2O4Se2 and a molecular weight of 407.0 g/mol. IUPAC name: (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid;dihydrochloride. InChIKey: JDPPDEWGHCUHMQ-RGVONZFCSA-N.
| Molecular formula | C6H14Cl2N2O4Se2 |
|---|---|
| Molecular weight | 407.0 g/mol |
| IUPAC name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid;dihydrochloride |
| InChIKey | JDPPDEWGHCUHMQ-RGVONZFCSA-N |
| SMILES | C([C@@H](C(=O)O)N)[Se][Se]C[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)