CAS 1021493-52-6 appears in our catalog under these names: Trifluoro-methanesulfonic acid 2-methoxy-4-formyl-6-nitro-phenyl ester, 95%, 4-Formyl-2-methoxy-6-nitrophenyl trifluoromethanesulfonate, 95+%, Trifluoro-methanesulfonic acid 2-methoxy-4-formyl-6-nitro-phenyl ester, 98%, 98%, 4-Formyl-2-methoxy-6-nitrophenyl trifluoromethanesulfonate, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(4-formyl-2-methoxy-6-nitrophenyl) trifluoromethanesulfonate (CAS 1021493-52-6) is a chemical compound with the molecular formula C9H6F3NO7S and a molecular weight of 329.21 g/mol. IUPAC name: (4-formyl-2-methoxy-6-nitrophenyl) trifluoromethanesulfonate. InChIKey: UJHAJLHOIGFTGF-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO7S |
|---|---|
| Molecular weight | 329.21 g/mol |
| IUPAC name | (4-formyl-2-methoxy-6-nitrophenyl) trifluoromethanesulfonate |
| InChIKey | UJHAJLHOIGFTGF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OS(=O)(=O)C(F)(F)F)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)