Products 1021684-61-6
CAS 1021684-61-6 is the registry number for 2,5-Dimethoxyamphetamine-d6. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-[2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine (CAS 1021684-61-6) is a chemical compound with the molecular formula C11H17NO2 and a molecular weight of 201.29 g/mol. IUPAC name: 1-[2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine. InChIKey: LATVFYDIBMDBSY-XERRXZQWSA-N.
| Molecular formula | C11H17NO2 |
|---|---|
| Molecular weight | 201.29 g/mol |
| IUPAC name | 1-[2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine |
| InChIKey | LATVFYDIBMDBSY-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1)OC([2H])([2H])[2H])CC(C)N |
Computed by PubChem (NCBI)