Products 1021869-59-9
CAS 1021869-59-9 is the registry number for AqF026, 99.05%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 10 mg, 25 mg, 5 mg.
Methyl 5-(benzylsulfamoyl)-4-chloro-2-(furan-2-ylmethylamino)benzoate (CAS 1021869-59-9) is a chemical compound with the molecular formula C20H19ClN2O5S and a molecular weight of 434.9 g/mol. IUPAC name: methyl 5-(benzylsulfamoyl)-4-chloro-2-(furan-2-ylmethylamino)benzoate. InChIKey: MXHXLONRCSGSEY-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN2O5S |
|---|---|
| Molecular weight | 434.9 g/mol |
| IUPAC name | methyl 5-(benzylsulfamoyl)-4-chloro-2-(furan-2-ylmethylamino)benzoate |
| InChIKey | MXHXLONRCSGSEY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1NCC2=CC=CO2)Cl)S(=O)(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)