Products 1021939-05-8

CAS 1021939-05-8 appears in our catalog under these names: 3-Cyclopropyl-3-methylbutanoic acid, 95%, 3-Cyclopropyl-3-methylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-cyclopropyl-3-methylbutanoic acid (CAS 1021939-05-8) is a chemical compound with the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. IUPAC name: 3-cyclopropyl-3-methylbutanoic acid. InChIKey: BYKZSXIJPNCMRD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O2
Molecular weight142.20 g/mol
IUPAC name3-cyclopropyl-3-methylbutanoic acid
InChIKeyBYKZSXIJPNCMRD-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)O)C1CC1

Computed by PubChem (NCBI)