CAS 102199-53-1 is the registry number for Ceftibuten Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enedioic acid (CAS 102199-53-1) is a chemical compound with the molecular formula C16H14N2O6S and a molecular weight of 362.4 g/mol. IUPAC name: 2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enedioic acid. InChIKey: KCJOTWMQVWNZSP-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O6S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]pent-2-enedioic acid |
| InChIKey | KCJOTWMQVWNZSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=NC(=CS2)C(=CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)