Products 1021998-59-3
CAS 1021998-59-3 is the registry number for phenyl-N-(4-(2,6,6-trimethyl-4-oxo(5,6,7-trihydroindolyl))phenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)phenyl]benzamide (CAS 1021998-59-3) is a chemical compound with the molecular formula C24H24N2O2 and a molecular weight of 372.5 g/mol. IUPAC name: N-[4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)phenyl]benzamide. InChIKey: FKGHGKOHBDYHTH-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O2 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | N-[4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)phenyl]benzamide |
| InChIKey | FKGHGKOHBDYHTH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)NC(=O)C4=CC=CC=C4)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)