CAS 1022-07-7 is the registry number for N-Methyl-2,4,6-trinitroaniline, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
N-methyl-2,4,6-trinitroaniline (CAS 1022-07-7) is a chemical compound with the molecular formula C7H6N4O6 and a molecular weight of 242.15 g/mol. IUPAC name: N-methyl-2,4,6-trinitroaniline. InChIKey: CFYAUGJHWXGWHI-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O6 |
|---|---|
| Molecular weight | 242.15 g/mol |
| IUPAC name | N-methyl-2,4,6-trinitroaniline |
| InChIKey | CFYAUGJHWXGWHI-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)