CAS 1022045-36-8 is the registry number for methyl 2-(4,5-dimethoxy-2-(((3-(trifluoromethyl)phenyl)amino)sulfonyl)phenyl)acetate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
Methyl 2-[4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetate (CAS 1022045-36-8) is a chemical compound with the molecular formula C18H18F3NO6S and a molecular weight of 433.4 g/mol. IUPAC name: methyl 2-[4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetate. InChIKey: PLXXGPQHKNWMNX-UHFFFAOYSA-N.
| Molecular formula | C18H18F3NO6S |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | methyl 2-[4,5-dimethoxy-2-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetate |
| InChIKey | PLXXGPQHKNWMNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)OC)S(=O)(=O)NC2=CC=CC(=C2)C(F)(F)F)OC |
Computed by PubChem (NCBI)