Products 102210-02-6

CAS 102210-02-6 appears in our catalog under these names: 3,3,3-Trifluoro-2-methyl- L-Alanine, H-alpha-Tfm-D-Ala-OH. Offered by: TRC, Iris Biotech. Available pack sizes: 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-3,3,3-trifluoro-2-methylpropanoic acid (CAS 102210-02-6) is a chemical compound with the molecular formula C4H6F3NO2 and a molecular weight of 157.09 g/mol. IUPAC name: 2-amino-3,3,3-trifluoro-2-methylpropanoic acid. InChIKey: JBQBFDPQDFDHEC-UHFFFAOYSA-N.

Identity
Molecular formulaC4H6F3NO2
Molecular weight157.09 g/mol
IUPAC name2-amino-3,3,3-trifluoro-2-methylpropanoic acid
InChIKeyJBQBFDPQDFDHEC-UHFFFAOYSA-N
SMILESCC(C(=O)O)(C(F)(F)F)N

Computed by PubChem (NCBI)