Products 1022209-11-5
CAS 1022209-11-5 is the registry number for 2-(4-chlorophenoxy)-N-(3-(phenylmethoxy)(2-pyridyl))ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(4-chlorophenoxy)-N-(3-phenylmethoxy-2-pyridinyl)acetamide (CAS 1022209-11-5) is a chemical compound with the molecular formula C20H17ClN2O3 and a molecular weight of 368.8 g/mol. IUPAC name: 2-(4-chlorophenoxy)-N-(3-phenylmethoxy-2-pyridinyl)acetamide. InChIKey: UXOASOWSERTJAD-UHFFFAOYSA-N.
| Molecular formula | C20H17ClN2O3 |
|---|---|
| Molecular weight | 368.8 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)-N-(3-phenylmethoxy-2-pyridinyl)acetamide |
| InChIKey | UXOASOWSERTJAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC=C2)NC(=O)COC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)