CAS 1022367-69-6 appears in our catalog under these names: TT01001, 97%, Ethyl 4–(3–(3，5–dichlorophenyl)thioureido)piperidine–1–carboxylate, TT01001/ 100%, TT01001, TT01001, 99.38%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 10mg, 50mg, 100mg, 10 mg, 25 mg.
Ethyl 4-[(3,5-dichlorophenyl)carbamothioylamino]piperidine-1-carboxylate (CAS 1022367-69-6) is a chemical compound with the molecular formula C15H19Cl2N3O2S and a molecular weight of 376.3 g/mol. IUPAC name: ethyl 4-[(3,5-dichlorophenyl)carbamothioylamino]piperidine-1-carboxylate. InChIKey: IBKBNNZZQOIWCI-UHFFFAOYSA-N.
| Molecular formula | C15H19Cl2N3O2S |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | ethyl 4-[(3,5-dichlorophenyl)carbamothioylamino]piperidine-1-carboxylate |
| InChIKey | IBKBNNZZQOIWCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(CC1)NC(=S)NC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)