CAS 1022421-06-2 appears in our catalog under these names: 1-{[4-Bromo-2-(trifluoromethoxy)benzene]sulfonyl}piperidine, 98%, 1-((4-Bromo-2-(trifluoromethoxy)phenyl)sulfonyl)piperidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylpiperidine (CAS 1022421-06-2) is a chemical compound with the molecular formula C12H13BrF3NO3S and a molecular weight of 388.20 g/mol. IUPAC name: 1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylpiperidine. InChIKey: JJYVZANEVBSQTG-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO3S |
|---|---|
| Molecular weight | 388.20 g/mol |
| IUPAC name | 1-[4-bromo-2-(trifluoromethoxy)phenyl]sulfonylpiperidine |
| InChIKey | JJYVZANEVBSQTG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=C(C=C(C=C2)Br)OC(F)(F)F |
Computed by PubChem (NCBI)