CAS 1022468-92-3 is the registry number for 1-phenyl-N-(4-(trifluoromethyl)phenyl)cyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-phenyl-N-[4-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide (CAS 1022468-92-3) is a chemical compound with the molecular formula C19H18F3NO and a molecular weight of 333.3 g/mol. IUPAC name: 1-phenyl-N-[4-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide. InChIKey: HVBPLANCGLAQCN-UHFFFAOYSA-N.
| Molecular formula | C19H18F3NO |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 1-phenyl-N-[4-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
| InChIKey | HVBPLANCGLAQCN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)