CAS 1022477-63-9 is the registry number for 3-phenyl-2-(phenylcarbonyl)indeno(3,2-c)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-benzoyl-3-phenylindeno[1,2-c]pyrazol-4-one (CAS 1022477-63-9) is a chemical compound with the molecular formula C23H14N2O2 and a molecular weight of 350.4 g/mol. IUPAC name: 2-benzoyl-3-phenylindeno[1,2-c]pyrazol-4-one. InChIKey: RFNHBCNNJPHAEH-UHFFFAOYSA-N.
| Molecular formula | C23H14N2O2 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-benzoyl-3-phenylindeno[1,2-c]pyrazol-4-one |
| InChIKey | RFNHBCNNJPHAEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C(=NN2C(=O)C4=CC=CC=C4)C5=CC=CC=C5C3=O |
Computed by PubChem (NCBI)