CAS 1022560-01-5 is the registry number for N-[3,5-Bis(trifluoromethyl)phenyl]morpholine-4-carboxamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N-[3,5-bis(trifluoromethyl)phenyl]morpholine-4-carboxamide (CAS 1022560-01-5) is a chemical compound with the molecular formula C13H12F6N2O2 and a molecular weight of 342.24 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]morpholine-4-carboxamide. InChIKey: NZOZCZVARRZORG-UHFFFAOYSA-N.
| Molecular formula | C13H12F6N2O2 |
|---|---|
| Molecular weight | 342.24 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]morpholine-4-carboxamide |
| InChIKey | NZOZCZVARRZORG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)