CAS 1022674-69-6 is the registry number for 1-benzo(b)benzo(b)thiophen-2-yl-2,2-dimethylpropan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-dibenzothiophen-2-yl-2,2-dimethylpropan-1-one (CAS 1022674-69-6) is a chemical compound with the molecular formula C17H16OS and a molecular weight of 268.4 g/mol. IUPAC name: 1-dibenzothiophen-2-yl-2,2-dimethylpropan-1-one. InChIKey: ZXNLKIQZJIZDDZ-UHFFFAOYSA-N.
| Molecular formula | C17H16OS |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 1-dibenzothiophen-2-yl-2,2-dimethylpropan-1-one |
| InChIKey | ZXNLKIQZJIZDDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC2=C(C=C1)SC3=CC=CC=C32 |
Computed by PubChem (NCBI)