CAS 1022730-31-9 is the registry number for ((4-chloro-2-nitrophenyl)sulfonyl)(2-pyridylmethyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide (CAS 1022730-31-9) is a chemical compound with the molecular formula C12H10ClN3O4S and a molecular weight of 327.74 g/mol. IUPAC name: 4-chloro-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide. InChIKey: UJPXHKOZPBIOIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O4S |
|---|---|
| Molecular weight | 327.74 g/mol |
| IUPAC name | 4-chloro-2-nitro-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| InChIKey | UJPXHKOZPBIOIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNS(=O)(=O)C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)