CAS 1022731-86-7 is the registry number for 3-(2,4-dichlorophenyl)-7-methyl-1,4,6,7,8-pentahydrocinnolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(2,4-dichlorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-cinnolin-5-one (CAS 1022731-86-7) is a chemical compound with the molecular formula C15H14Cl2N2O and a molecular weight of 309.2 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-cinnolin-5-one. InChIKey: RJFKXXLIQZIQHP-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2N2O |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-7-methyl-4,6,7,8-tetrahydro-1H-cinnolin-5-one |
| InChIKey | RJFKXXLIQZIQHP-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(CC(=NN2)C3=C(C=C(C=C3)Cl)Cl)C(=O)C1 |
Computed by PubChem (NCBI)