CAS 102284-85-5 is the registry number for 2-Azido-1,3-difluorobenzene, 2-methoxy-2-methylpropane. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-azido-1,3-difluorobenzene (CAS 102284-85-5) is a chemical compound with the molecular formula C6H3F2N3 and a molecular weight of 155.10 g/mol. IUPAC name: 2-azido-1,3-difluorobenzene. InChIKey: XPVKWBQVANKPLZ-UHFFFAOYSA-N.
| Molecular formula | C6H3F2N3 |
|---|---|
| Molecular weight | 155.10 g/mol |
| IUPAC name | 2-azido-1,3-difluorobenzene |
| InChIKey | XPVKWBQVANKPLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N=[N+]=[N-])F |
Computed by PubChem (NCBI)