CAS 1022892-14-3 is the registry number for 4-(3-methyl-4-(isopropyl)phenyl)-3-(4-pyridyl)-1,2,4-triazoline-5-thione. Offered by: Biosynth. Available pack sizes: 250mg.
4-(3-methyl-4-propan-2-ylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (CAS 1022892-14-3) is a chemical compound with the molecular formula C17H18N4S and a molecular weight of 310.4 g/mol. IUPAC name: 4-(3-methyl-4-propan-2-ylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione. InChIKey: XDFSWNXPXJMPGB-UHFFFAOYSA-N.
| Molecular formula | C17H18N4S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 4-(3-methyl-4-propan-2-ylphenyl)-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | XDFSWNXPXJMPGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=NNC2=S)C3=CC=NC=C3)C(C)C |
Computed by PubChem (NCBI)