Products 1023356-72-0
CAS 1023356-72-0 is the registry number for (4-(4,5-dichloroimidazolyl)phenyl)(2-naphthylsulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(4,5-dichloroimidazol-1-yl)phenyl]naphthalene-2-sulfonamide (CAS 1023356-72-0) is a chemical compound with the molecular formula C19H13Cl2N3O2S and a molecular weight of 418.3 g/mol. IUPAC name: N-[4-(4,5-dichloroimidazol-1-yl)phenyl]naphthalene-2-sulfonamide. InChIKey: UGWJKCTYWDMAQL-UHFFFAOYSA-N.
| Molecular formula | C19H13Cl2N3O2S |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | N-[4-(4,5-dichloroimidazol-1-yl)phenyl]naphthalene-2-sulfonamide |
| InChIKey | UGWJKCTYWDMAQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NC3=CC=C(C=C3)N4C=NC(=C4Cl)Cl |
Computed by PubChem (NCBI)