CAS 1023431-51-7 is the registry number for 1,3-diphenyl-5-(3-thienylmethylene)-1,3-diazaperhydroine-2,4,6-trione. Offered by: Biosynth. Available pack sizes: 250mg.
1,3-diphenyl-5-(thiophen-3-ylmethylidene)-1,3-diazinane-2,4,6-trione (CAS 1023431-51-7) is a chemical compound with the molecular formula C21H14N2O3S and a molecular weight of 374.4 g/mol. IUPAC name: 1,3-diphenyl-5-(thiophen-3-ylmethylidene)-1,3-diazinane-2,4,6-trione. InChIKey: RYTCDGMUVPFQPP-UHFFFAOYSA-N.
| Molecular formula | C21H14N2O3S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 1,3-diphenyl-5-(thiophen-3-ylmethylidene)-1,3-diazinane-2,4,6-trione |
| InChIKey | RYTCDGMUVPFQPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=CC3=CSC=C3)C(=O)N(C2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)