Products 1023456-03-2
CAS 1023456-03-2 is the registry number for 3-(3,4-dimethoxyphenyl)-1,6-dimethyl-5,6,7-trihydro1H-indazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(3,4-dimethoxyphenyl)-1,6-dimethyl-6,7-dihydro-5H-indazol-4-one (CAS 1023456-03-2) is a chemical compound with the molecular formula C17H20N2O3 and a molecular weight of 300.35 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1,6-dimethyl-6,7-dihydro-5H-indazol-4-one. InChIKey: MKWZZJVPJCUJOR-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O3 |
|---|---|
| Molecular weight | 300.35 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1,6-dimethyl-6,7-dihydro-5H-indazol-4-one |
| InChIKey | MKWZZJVPJCUJOR-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=O)C1)C(=NN2C)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)