CAS 1023476-02-9 is the registry number for ethyl 3-((5-chloro-2-methoxyphenyl)amino)-5-methyl-2,4-thiazolecarboxylate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl 2-(5-chloro-2-methoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate (CAS 1023476-02-9) is a chemical compound with the molecular formula C14H15ClN2O3S and a molecular weight of 326.8 g/mol. IUPAC name: ethyl 2-(5-chloro-2-methoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: YXWPBPUTYYDMQT-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O3S |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | ethyl 2-(5-chloro-2-methoxyanilino)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | YXWPBPUTYYDMQT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC2=C(C=CC(=C2)Cl)OC)C |
Computed by PubChem (NCBI)