CAS 1023476-28-9 is the registry number for N-(3-bromophenyl)-1-phenylcyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3-bromophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1023476-28-9) is a chemical compound with the molecular formula C18H18BrNO and a molecular weight of 344.2 g/mol. IUPAC name: N-(3-bromophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: WEDRDHVXLOWTAR-UHFFFAOYSA-N.
| Molecular formula | C18H18BrNO |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | N-(3-bromophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | WEDRDHVXLOWTAR-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)