CAS 1023496-38-9 is the registry number for (((4-(4,5-dichloroimidazolyl)phenyl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[4-(4,5-dichloroimidazol-1-yl)anilino]methylidene]propanedinitrile (CAS 1023496-38-9) is a chemical compound with the molecular formula C13H7Cl2N5 and a molecular weight of 304.13 g/mol. IUPAC name: 2-[[4-(4,5-dichloroimidazol-1-yl)anilino]methylidene]propanedinitrile. InChIKey: AYMRHFLALLYUEW-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N5 |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | 2-[[4-(4,5-dichloroimidazol-1-yl)anilino]methylidene]propanedinitrile |
| InChIKey | AYMRHFLALLYUEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC=C(C#N)C#N)N2C=NC(=C2Cl)Cl |
Computed by PubChem (NCBI)