CAS 1023496-55-0 is the registry number for 2-nitrophenyl 4-(5-(trifluoromethyl)(2-pyridyl))piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(2-nitrophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (CAS 1023496-55-0) is a chemical compound with the molecular formula C17H15F3N4O3 and a molecular weight of 380.32 g/mol. IUPAC name: (2-nitrophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone. InChIKey: XVDPUBCFOMQMOW-UHFFFAOYSA-N.
| Molecular formula | C17H15F3N4O3 |
|---|---|
| Molecular weight | 380.32 g/mol |
| IUPAC name | (2-nitrophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| InChIKey | XVDPUBCFOMQMOW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC=C(C=C2)C(F)(F)F)C(=O)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)