CAS 1023497-26-8 is the registry number for phenyl-N-(thioxo(((3-(trifluoromethoxy)phenyl)methyl)amino)methyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[[3-(trifluoromethoxy)phenyl]methylcarbamothioyl]benzamide (CAS 1023497-26-8) is a chemical compound with the molecular formula C16H13F3N2O2S and a molecular weight of 354.3 g/mol. IUPAC name: N-[[3-(trifluoromethoxy)phenyl]methylcarbamothioyl]benzamide. InChIKey: UYKGHTXZPMZNSS-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N2O2S |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | N-[[3-(trifluoromethoxy)phenyl]methylcarbamothioyl]benzamide |
| InChIKey | UYKGHTXZPMZNSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NCC2=CC(=CC=C2)OC(F)(F)F |
Computed by PubChem (NCBI)