CAS 1023497-28-0 is the registry number for 4-(4-methylphenyl)-1-(2-(2,3-dichlorophenoxy)phenoxy)acetyl)thiosemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(2,3-dichlorophenoxy)acetyl]amino]-3-(4-methylphenyl)thiourea (CAS 1023497-28-0) is a chemical compound with the molecular formula C16H15Cl2N3O2S and a molecular weight of 384.3 g/mol. IUPAC name: 1-[[2-(2,3-dichlorophenoxy)acetyl]amino]-3-(4-methylphenyl)thiourea. InChIKey: KYRXSEBRSXKUSW-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N3O2S |
|---|---|
| Molecular weight | 384.3 g/mol |
| IUPAC name | 1-[[2-(2,3-dichlorophenoxy)acetyl]amino]-3-(4-methylphenyl)thiourea |
| InChIKey | KYRXSEBRSXKUSW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=S)NNC(=O)COC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)