CAS 1023513-81-6 is the registry number for 1-phenyl-N-(4-(phenylamino)phenyl)cyclopentane-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(4-anilinophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1023513-81-6) is a chemical compound with the molecular formula C24H24N2O and a molecular weight of 356.5 g/mol. IUPAC name: N-(4-anilinophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: YEOFSQXYZIVRPV-UHFFFAOYSA-N.
| Molecular formula | C24H24N2O |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | N-(4-anilinophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | YEOFSQXYZIVRPV-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=CC=C(C=C3)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)