CAS 1023515-09-4 is the registry number for N-tert-butyl-4-(5-chloro-2-methylphenyl)piperazine-1-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-tert-butyl-4-(5-chloro-2-methylphenyl)piperazine-1-carboxamide (CAS 1023515-09-4) is a chemical compound with the molecular formula C16H24ClN3O and a molecular weight of 309.83 g/mol. IUPAC name: N-tert-butyl-4-(5-chloro-2-methylphenyl)piperazine-1-carboxamide. InChIKey: CCVZFNLQHVQYBS-UHFFFAOYSA-N.
| Molecular formula | C16H24ClN3O |
|---|---|
| Molecular weight | 309.83 g/mol |
| IUPAC name | N-tert-butyl-4-(5-chloro-2-methylphenyl)piperazine-1-carboxamide |
| InChIKey | CCVZFNLQHVQYBS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)