CAS 1023515-74-3 is the registry number for 2-((diphenylamino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(N-phenylanilino)methylidene]indene-1,3-dione (CAS 1023515-74-3) is a chemical compound with the molecular formula C22H15NO2 and a molecular weight of 325.4 g/mol. IUPAC name: 2-[(N-phenylanilino)methylidene]indene-1,3-dione. InChIKey: TUIIGWUWFSQAEG-UHFFFAOYSA-N.
| Molecular formula | C22H15NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-[(N-phenylanilino)methylidene]indene-1,3-dione |
| InChIKey | TUIIGWUWFSQAEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C=C2C(=O)C3=CC=CC=C3C2=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)