Products 1023526-17-1
CAS 1023526-17-1 is the registry number for N-(2-fluoro-5-methylphenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-fluoro-5-methylphenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1023526-17-1) is a chemical compound with the molecular formula C19H20FNO and a molecular weight of 297.4 g/mol. IUPAC name: N-(2-fluoro-5-methylphenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: JAFSBUJVKRWILH-UHFFFAOYSA-N.
| Molecular formula | C19H20FNO |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | N-(2-fluoro-5-methylphenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | JAFSBUJVKRWILH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)F)NC(=O)C2(CCCC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)