CAS 1023528-16-6 is the registry number for (4-(4-chloro-3-methylphenyl)(2,5-thiazolyl))-4-pyridylamine. Offered by: Biosynth. Available pack sizes: 250mg.
4-(4-chloro-3-methylphenyl)-N-pyridin-4-yl-1,3-thiazol-2-amine (CAS 1023528-16-6) is a chemical compound with the molecular formula C15H12ClN3S and a molecular weight of 301.8 g/mol. IUPAC name: 4-(4-chloro-3-methylphenyl)-N-pyridin-4-yl-1,3-thiazol-2-amine. InChIKey: DLRJOYRBVZJEIC-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3S |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | 4-(4-chloro-3-methylphenyl)-N-pyridin-4-yl-1,3-thiazol-2-amine |
| InChIKey | DLRJOYRBVZJEIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CSC(=N2)NC3=CC=NC=C3)Cl |
Computed by PubChem (NCBI)